Predloga:Infopolje Učinkovina
{{Infopolje Učinkovina}} je infopolje namenjeno učinkovinam, tako medicinskim kot tudi rekreacijskim drogam.
Tip učinkovine
[uredi kodo]- Uporabimo parameter
|type=...
Samostojna kemikalija
[uredi kodo]|type=<blank>
Drugs that are a simple chemical compound (približno 90% člankov o učinkovinah). Skrajšani seznam parametrov:
{{Infopolje Učinkovina
| drug_name =
| INN =
| type =<!-- empty -->
| IUPAC_name =
| image =
| alt =
| caption =
<!-- Clinical data -->
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_AU_comment =
| pregnancy_US = <!-- A/B/C/D/X/N -->
| pregnancy_category=
| routes_of_administration =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_DE = <!-- Anlage I, II, III -->
| legal_NZ = <!-- Class A, B, C -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_US = <!-- OTC/Rx-only/Schedule I, II, III, IV, V -->
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_status = <!-- Free text -->
<!-- Pharmacokinetic data -->
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
<!-- Identifiers -->
| CAS_number =
| ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix =
| PubChem =
| DrugBank =
<!-- Chemical data -->
| chemical_formula =
| molecular_weight =
}}
Celotna predloga z vsemi paarametri:
{{Infopolje Učinkovina
| drug_name =
| INN =
| type =<!-- empty -->
| IUPAC_name =
| image =
| width =
| alt =
| image2 =
| width2 =
| alt2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| caption =
<!-- Clinical data -->
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_EU = <!-- EMA requires brand name -->
| licence_US = <!-- FDA may use generic name -->
| DailyMedID = <!-- preference to licence_US -->
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_AU_comment =
| pregnancy_US = <!-- A / B / C / D / X / N -->
| pregnancy_US_comment =
| pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled-->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment =
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US_comment =
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_UN_comment =
| legal_status = <!--For countries not listed above-->
<!-- Pharmacokinetic data -->
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
<!-- Identifiers -->
| CAS_number =
| CAS_supplemental =
| ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix =
| ATC_supplemental =
| PubChem =
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID =
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| NIAID_ChemDB =
| synonyms =
<!-- Chemical data -->
| chemical_formula =
| C= | H= | Ag= | Al= | As= | Au= | B= | Bi= | Br= | Ca= | Cl= | Co= | F= | Fe= | Gd= | I=
| K= | Li= | Mg= | Mn= | N= | Na= | O= | P= | Pt= | S= | Sb= | Se= | Sr= | Tc= | Zn= | charge=
| molecular_weight =
| SMILES =
| StdInChI =
| StdInChI_comment =
| StdInChIKey =
| density =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| specific_rotation =
| sec_combustion =
}}
Kombinacija učinkovin
[uredi kodo]|type=combo
Za kombinacije učinkovin, morata biti definirani najmanj dve snovi (opcijsko 3. in 4. ) snov. Za vsako komponento učinkovine velja:
| component1 =<!-- ime, avtomatsko wikificirano --> | class1 =<!-- class of agent, needs manual wikilinking -->
Primer za učinkovino Seretide:
| Kombinacija | |
|---|---|
| Fluticasone | Glucocorticoid |
| Salmeterol | Long-acting beta2 agonist |
| drug_name = Seretide | type = combo | component1 = Fluticasone | class1 = [[Glucocorticoid]] | component2 = Salmeterol | class2 = [[Beta2-adrenergic receptor agonist|Long-acting beta2 agonist]]
Generally combination articles will not need to display the molecular images of its constituents (the relevant specific articles would have the images). It disables all Chemical & Pharmacology parameters (which describe properties of single drug items). These redundant disabled parameters are best not included in the template calling, so use the following abridged forms of the template:
Shortened combination product form:
{{Infopolje Učinkovina
| drug_name =
| type = combo
| component1 = <!-- Drugname, automatically linked -->
| class1 = <!-- Group, manual link using [[..|..]] -->
| component2 = <!-- Drugname, automatically linked -->
| class2 = <!-- Group, manual link using [[..|..]] -->
<!-- Clinical data -->
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_US = <!-- A/B/C/D/X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_NZ = <!--Class A, B, C -->
| legal_status =
| routes_of_administration =
<!-- Identifiers -->
| CAS_number =
| ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix =
| PubChem =
| DrugBank =
}}
Full combination product template with extended fields and allowing for up to 4 items:
{{Infopolje Učinkovina
| drug_name =
| type = combo
| component1 = <!-- Drugname, automatically linked -->
| class1 = <!-- Group, manual link using [[..|..]] -->
| component2 = <!-- Drugname, automatically linked -->
| class2 = <!-- Group, manual link using [[..|..]] -->
| component3 = <!-- Drugname, automatically linked -->
| class3 = <!-- Group, manual link using [[..|..]] -->
| component4 = <!-- Drugname, automatically linked -->
| class4 = <!-- Group, manual link using [[..|..]] -->
<!-- Clinical data -->
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_EU = <!-- EMA requires brand name -->
| licence_US = <!-- FDA may use generic name -->
| DailyMedID = <!-- preference to licence_US -->
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_US = <!-- A/B/C/D/X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
<!-- Identifiers -->
| CAS_number =
| CAS_supplemental =
| ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix =
| ATC_supplemental =
| PubChem =
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID =
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms =
}}
Monoclonal antibody drugs
[uredi kodo]|type=mab
This form the box uses parameters:
| type = mab | mab_type = | source = | target =
For example Catumaxomab:
| Monoklonsko protitelo | |
|---|---|
| Tip | trifunkcionalno protitelo |
| Izvor | Podgana/mišji hibrid |
| Tarča | EpCAM, CD3 |
| type = mab | mab_type = 3funct | source = axo | target = [[EpCAM]], [[CD3 (immunology)|CD3]]
mab_type defines one of the following types of antibody or antibody fragment:
| mab_type | output |
|---|---|
| mab | Whole antibody |
| Fab | Fab fragment |
| F(ab')2 | F(ab')2 fragment |
| Fab' | Fab' fragment |
| scFv | Single-chain variable fragment |
| di-scFv | Di-single-chain variable fragment |
| sdAb | Single domain antibody |
| 3funct | Trifunctional antibody |
| clFab | Chemically linked Fab |
| BiTE | Bi-specific T-cell engager |
source is the species on which the protein sequence of the antibody is based:
| source | output |
|---|---|
| a | Rat |
| e | Hamster |
| i | Primate |
| o | Mouse |
| u | Human |
| xi/a, xi/e, etc. | Chimeric (rat/human) etc. |
| xi | Chimeric [generic, use only if values above are not applicable] |
| zu/a, zu/e, etc. | Humanized (from rat) etc. |
| zu | Humanized [generic, use only if values above are not applicable] |
| xizu/a, xizu/e, etc. | Chimeric/humanized hybrid (rat/human) etc. |
| xizu | Chimeric/humanized hybrid [generic, use only if values above are not applicable] |
| axo | Rat/mouse hybrid |
target is the antigen at which the antibody is directed. This parameter takes free text as value, preferably including a wikilink such as |target=[[TNF-α]].
The drug name is followed by a "?" linked to Nomenclature of monoclonal antibodies, saving the need to explain how each monoclonal antibody has been named.
Shortened Monoclonal antibody form:
{{Infopolje Učinkovina
| type = mab
| image =
| alt =
| mab_type = <!-- mab, Fab, F(ab')2, Fab', scFv, di-scFv, 3funct, clFab, BiTE -->
| source = <!-- a, e, i, o, u, xi/a, zu/a, xizu/a, axo, ... -->
| target = <!-- antigen, not the code number of the monoclonal antibody! -->
<!-- Clinical data -->
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_US = <!-- A/B/C/D/X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled -->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_NZ = <!--Class A, B, C -->
| legal_status =
| routes_of_administration =
<!-- Pharmacokinetic data -->
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
<!-- Identifiers -->
| CAS_number =
| ATC_prefix = <!-- 'none' when not assigned -->
| ATC_suffix =
| PubChem =
| DrugBank =
}}
Cepiva
[uredi kodo]|type=vaccine
This allows the alternative parameters of the vaccine_type and target to be specified:
- target can be any text. CAn be used to link to a specific article
- vaccine_type must be from the defined list of options as described at Cepivo#Vrste cepiv, the infobox will provide standardised display and links as follows:
| vaccine_type value | Output |
|---|---|
| killed or inactivated | Killed/Inactivated |
| attenuated | Attenuated virus |
| live | Live bacteria |
| toxoid | Toxoid |
| protein or protein subunit | Protein subunit |
| subunit | Subunit |
| conjugate | Conjugate vaccine |
| recombinant | Recombinant Vector |
| DNA | DNA vaccination |
Where a vaccination product protects against more than one agent, please use the combination form of this infobox with type=combo (per #Combination products), and each classX=[[Cepivo]].
Shortened Vaccine form:
{{Infopolje Učinkovina
| drug_name =
| type = vaccine
| image =
| alt =
| target = <!-- the antigen/bacteria/toxin/virus to protect against -->
| vaccine_type = <!-- killed/attenuated/live/toxoid/protein subunit/subunit/conjugate/recombinant/DNA -->
<!-- Clinical data -->
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_US = <!-- A/B/C/D/X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_NZ = <!--Class A, B, C -->
| legal_status =
| routes_of_administration =
<!-- Identifiers -->
| CAS_number =
| ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix =
| PubChem =
| DrugBank =
}}
Full Vaccine template with extended fields:
{{Infopolje Učinkovina
| drug_name =
| type = vaccine
| image =
| alt =
| width =
| image2 =
| alt2 =
| width2 =
| target = <!-- the antigen/bacteria/toxin/virus to protect against -->
| vaccine_type = <!-- killed/attenuated/live/toxoid/protein subunit/subunit/conjugate/recombinant/DNA -->
<!-- Clinical data -->
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_EU = <!-- EMA requires brand name -->
| licence_US = <!-- FDA may use generic name -->
| DailyMedID = <!-- preference to licence_US -->
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_US = <!-- A/B/C/D/X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_NZ = <!--Class A, B, C -->
| legal_status =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
<!-- Identifiers -->
| CAS_number =
| CAS_supplemental =
| ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix =
| ATC_supplemental =
| PubChem =
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID =
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| NIAID_ChemDB =
}}
Parameters
[uredi kodo]- See also: full parameter list
Infobox title and INN
[uredi kodo] |
By default, the title of the infobox is the article title. You can overwrite that using
|drug_name=. Do not add any other specifiers or links (especially, do not add "BAN" or "USAN").
Per the Manual of Style, the infobox title must be the International nonproprietary name (INN). There is a tooltip text referring to INN.
When, for some reason, the title is not the INN, the correct INN can be added as a subtitle using |INN=
|
| drug_name = Heroin | INN = Diamorphine
When the drug has no INN at all, setting |INN=none will suppress the tooltip text mentioning INN.
- See also #Names and identifiers
Images
[uredi kodo]You can use the image to provide an illustration. A caption can be added. The alt parameter is a textual description of the image, and is shown in the 'tooltip' and read by visually impaired readers (more in WP:ALT). Parameter width sets the width in px; default width is 200px.
 3D-structure |
| image = Acetylsalicylsäure2.svg | caption = 3D-structure | alt = Molecule of aspirin | width = 125
A second image can be added using image2:
| image2 = | caption2 = | alt2 = | width2 =
Also a side-by-side pair of images can be added (with single caption):
| imageL = | widthL = | altL = | imageR= | widthR = | altR = | captionLR =
Clinical data
[uredi kodo]| tradename = | Drugs.com = | MedlinePlus = | routes_of_administration =
- tradename – comma separated list of tradenames
- Drugs.com – link to Drugs.com monograph
- MedlinePlus – MedlinePlus drug accession number
Pregnancy category
[uredi kodo]- See also pregnancy category, documentation for extensive documentation
Pregnancy Categorisation has been previously declared using just the pregnancy_category parameter with a variety of markup styles used to indicate various countries and their classifications. Alternatively pregnancy_AU and pregnancy_US may be set to the fixed categories. For Australia values permitted are: A, B1, B2, B3, C, D or X (note if just set to 'B' then B? is shown). For US values permitted are: A, B, C, D or X.
Note the UK does not have official designated categorisations, but has both a variety of standard phrases with explanatory qualifications, plus many individual descriptions. The generic |pregnancy_category= acceptts any text, and may be used with such country-specific information (non AU or US).
For the new US labeling guidelines PLLR, parameter |PLLR= is added and will show any input text (not re-formatted).
| Klinični podatki | |
|---|---|
| Nosečnostna kategorija | |
| pregnancy_AU = B1 | pregnancy_AU_comment = any text | pregnancy_US = C | pregnancy_US_comment = any text | pregnancy_category = Used in pregnancy against [[Pregnancy-induced hypertension|PIH]] | PLLR = Some PLLR text
Dependence liability
[uredi kodo]Optional parameters Dependence liability and Addiction_liability allow opioids or benzodiazepines to be flagged with the risk of becoming dependent/addicted upon them, although in many cases this may be somewhat subjective. Drugs should be rated as Low, Medium, High or Extremely high:
| dependency_liability = High | addiction_liabiliy = High
Licensing information
[uredi kodo]There are two major licensing authorities that make drug information easily accessible: The US Food and Drug Administration (FDA) and the European Medicines Agency (EMA). NB: The word "licence" is the noun in British English, "license" is the verb.
The FDA "Label Information" and the EMA "Product Information", where available, are very detailed. There is material aimed at the professional and also plain-English consumer information. These are excellent reliable source for article information but also contains much that makes it a worthwhile "External link" since there is no way one can include all the info. Both sites work using of the brand name of the drug but the FDA site also allows searches with the generic name (active ingredient), which lists generic variants where they are licensed.
| licence_EU = <!-- EMA requires brand name --> | licence_US = <!-- FDA may use generic name -->
Lists of products and the parameter term to use may be easily searched for:
- European Public Assessment Reports: SiteMap, authorised products A–Z: human, veterinary
- When items are composed of more than one word, licence_EU uses adjoined words (i.e. no spaces); e.g. infanrixpenta for Infanrix Penta.
- Drugs@FDA Search by Drug Name or Active Ingredient
- Where items are composed of more than one word, licence_US requires an underscore '_' in place of any spaces; e.g. Acyclovir_Sodium.
More patient friendly than the FDA's pages is Daily Med which reproduces the same details. The DailyMedID parameter, where specified, is shown in preference to the licence_US direct FDA link. Daily Med entries may be located at Search By Drug Name, e.g. for Furosemide
| DailyMedID = 3940
Legal status
[uredi kodo]- See also: {{Infopolje Učinkovina/legal status}} for extensive documentation.
Legal status has been previously declared using just the legal_status parameter with a variety of markup styles used to indicate various countries and their classifications. Alternatively legal_AU, legal_EU legal_CA, legal_NZ, legal_UK, legal_UN, and legal_US may be set to the fixed options in the table hereafter. The template will ensure the categorisation is shown correctly capitalised, use Unicode Rx symbol and add a linked 2-letter country code as per WP:MOS. legal_status may still be used with the country-specific parameters as it is appended afterwards, allowing backwards compatibility for articles that only define this parameter, or for the future with free-text of other information.
Hence
| Pravni status | |
|---|---|
| Pravni status |
|
| legal_AU = S2 | legal_AU_comment = any text | legal_CA = | legal_UK = gsl | legal_US = Rx-only | legal_EU = | legal_UN = | legal_NZ = | legal_status = Not marketed in [[Asia]]
Returns:
Note: if a drug is restricted everywhere to prescription-only, please set legal_status = Rx-only rather than similarly define for each and every country ('Rx-only' is specifically recognised by legal_status and shows as ℞ Prescription only)
| Input | Meaning |
|---|---|
| legal_status | Anywhere |
| Rx-only | ℞ Prescription only |
| legal_AU | Australia (see SUSDP) |
| Unscheduled | Unscheduled/exempt |
| S2 | Schedule 2 Pharmacy Medicine |
| S3 | Schedule 3 Pharmacist Only Medicine |
| S4 | Schedule 4 Prescription Only Medicine |
| S5 | Schedule 5 Caution |
| S6 | Schedule 6 Poison |
| S7 | Schedule 7 Dangerous Poison |
| S8 | Schedule 8 Controlled Drug |
| S9 | Schedule 9 Prohibited Substance |
| legal_CA | Canada |
| OTC | Over the counter |
| Rx-only | ℞ Prescription only |
| Schedule I | See Controlled Drugs and Substances Act |
| Schedule II | |
| Schedule III | |
| Schedule IV | |
| Schedule V | |
| Schedule VI | |
| Schedule VII | |
| Schedule VIII | |
| legal_UK | United Kingdom |
| GSL | General Sale List |
| P | Pharmacy Medicine |
| POM | Prescription Only Medicine |
| CD | Controlled Drug; if known may specify: |
| CD Lic | See Misuse of Drugs Regulations 2001 (as amended) |
| CD POM | |
| CD No Reg POM | |
| CD (Benz) POM | |
| CD (Anab) POM | |
| CD Inv POM | |
| legal_US | United States |
| OTC | Over the counter |
| ℞-only Rx-only |
Prescription only; if appropriate may specify: |
| Schedule I | See Controlled Substances Act |
| Schedule II | |
| Schedule III | |
| Schedule IV | |
| Schedule V | |
| EU | |
| UN | |
| NZ |
Pharmacokinetic data
[uredi kodo]In general, these parameters are relevant ro a drug. Use wikilinks for values that the general reader might not understand (e. g. hepatic, CYP3A4, intraperitoneal).
| bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action= | excretion =
Names and identifiers
[uredi kodo]| parameter | label | demo | order | group | note | |
|---|---|---|---|---|---|---|
| {{PAGENAME}} | Amoxicillin | top | title | Infobox title | ||
drug_name =
|
N,N-Dimethyltryptamine | top | title | demo:1; overwrites {{PAGENAME}} | ||
| (type=vacc,mab,comb,other) | 01 | type | See /doc/type-sections | |||
IUPAC_name = |
Systematic (IUPAC) name | (2S,5R,6R)-6-{[(2R)-2-aminoetc. |
02 | type | Plain, long | |
SMILES = orsmiles =
|
SMILES | O=C(O)[C@@H]2N3C(=O)[C@@H]etc. |
03 | type | Plain, long, collapses | |
StdInChI =StdInChIKey = |
InChI | InChI=1S/C16H19N3O5S/c1-16(2)11etc.
Key:LSQZJLSetc. |
04 | type | Long, collapses. Not InChI, InChIKey | |
| Clinical data | 20 | clinical | ||||
tradename = |
Trade names | Actimoxi, Alphamox, etc. | 21 | clinical | Plain demo | |
Drugs.com = |
AHFS/Drugs.com | monograph | 23 | clinical | Input by {{drugs.com}} | |
MedlinePlus = |
MedlinePlus | a685001 | 25 | clinical | ||
licence_EU =DailyMedID =licence_US = |
Licence data |
|
26 | clinical | DailyMedID overwrites licence_US | |
| Identifiers | 50 | id | ||||
CAS_number =CAS_supplemental = |
CAS Registry Number | 91161-71-6 78628-80-5 | 51 | id | demo:4 | |
ATC_prefix = ATC_suffix =ATC_supplement = ATCvet = |
ATC code or ATCvet code |
ATCvet=no |ATC_prefix=J01 |ATC_suffix=CA04 |ATC_supplemental=QG51AA03 }} | 52 | class | Multi-input, interaction. Numbers have split wl+el! | |
PubChem = orPubChemSubstance = (SID) |
PubChem | CID: 33613 | 53 | id | Only one is shown | |
IUPHAR_ligand =
|
IUPHAR/BPS | 4139 | 54 | id | demo:2 | |
DrugBank =
|
DrugBank | DB01060 | 55 | id | ||
ChemSpiderID =
|
ChemSpider | 31006 | 56 | id | +Option '=none' | |
UNII =
|
UNII | 9EM05410Q9 | 57 | id | ||
KEGG =
|
KEGG | D07452 | 58 | id | ||
ChEBI =
|
ChEBI | CHEBI:2676 | 59 | id | ||
ChEMBL =
|
ChEMBL | CHEMBL1082 | 61 | id | ||
NIAID_ChemDB =
|
NIAID ChemDB | 059486 | 62 | id | demo:3; HIV/AIDS related | |
synonyms =
|
Synonyms | 2-acetoxybenzoic acid acetylsalicylate etc. |
63 | id | demo:2; Plain, list | |
PDB_ligand =
|
PDB ligand ID | AIN (PDBe, RCSB PDB) | 64 | id | demo:2 | |
E_number =
|
E number | E703 | 65 | id | Oxytetracycline | |
- Notes: Data is taken from various articles, for illustration purposes.
CAS Registry Number
[uredi kodo]|CAS_number=
Additional CAS codes may be included with optional |CAS_supplement= parameters in a comma-separated lists. CAS templates may be used to have these additional codes link to the relevant databases:
| CAS_supplemental ={{CAS|427-51-0}} (acetate)
Adds the following linked codes:
- For CAS - 427-51-0 (acetate)
- See also: Second identifiers and indexes
DrugBank
[uredi kodo]The DrugBank primary accession number (consisting of a 2 letter prefix (DB) and a 5 number suffix). Secondary accession numbers with a 4 letter suffix (APRD, EXPT, BIOD, NUTR) should not normally be used.
PubChem
[uredi kodo]When available, the PubChem compound identifier (CID) should be used because it is unique for each chemical compound:
| PubChem = 4091 <!-- Metformin -->
Make sure you choose the right CID: Often PubChem compound entries differ only very slightly, for example by an additional hydratation water or by a carbon atom with unspecified stereochemistry.
If no CID is available, which is usually the case when there is no structural information on PubChem, you may use one of the substance identifiers (SIDs):
| PubChemSubstance = 10099 <!-- Etanercept -->
The box won't display both CID and SID to avoid list cruft.
Verification, using parameters (like: CAS_number_Ref)
[uredi kodo]Seven identfying parameters like |CAS_number=are tracked in a WP:Drugbox data validation process. A bot adds parameters like
|verifiedrevid= and |CAS_number_Ref={{cascite|correct}}. See also {{cascite}} documentation.
ATC, ATCvet
[uredi kodo]Where the drug is not included in ATC coding system (as opposed to its value just not been entered into the template) then set ATC_prefix to 'none', and the article is automatically added to Category:Drugs not assigned an ATC code rather than Category:Drugboxes with an unspecified ATC code:
| ATC_prefix = none
Additional ATC may be included with the optional |ATC_supplemental= parameter as a comma-separated list. ATC templates may be used to have these additional codes link to the relevant databases:
| ATC_supplemental ={{ATC|M02|AA15}}, {{ATC|S01|BC03}}
Adds the following linked codes:
Veterinary drugs are placed in a slightly different classification system, ATCvet. The code may be specified as ATCvet by setting the parameter ATCvet to 'yes'. Do not include the leading 'Q' in ATC_prefix:
| ATCvet = yes | ATC_prefix = N05 | ATC_suffix = AX90
Second identifier (like: CAS_number2)
[uredi kodo]
Using second identifiers
| ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
All identifiers can have a second, index-2 identifier, representing a second chemical substance. For example, Additionally,
{{Infopolje Učinkovina
| drug_name=Demo indexes<br/>([[Diminazen]])
<!--Identifiers-->
| index0 =
| index2 =aceturate
| index0_comment = standard
| index2_comment = see [[aceturic acid]]
| CAS_number = 536-71-0
| CAS_number2 = 908-54-3
| PubChem = 2354
| UNII = Y5G36EEA5Z
| UNII2 = JI8SAD85NO
| DrugBank =
}}
| ||||||||||||||||||||||||||||
Chemical data
[uredi kodo]Chemical formula
[uredi kodo]Entering the chemical formula per element:
| C= | H= | Ag= | Al= | As= | Au= | B= | Bi= | Br= | Ca= | Cl= | Co= | F= | Fe= | Gd= | I= | K= | Li= | Mg= | Mn= | N= | Na= | O= | P= | Pt= | S= | Sb= | Se= | Sr= | Tc= | Zn= <!-- all 118 symbols --> | charge= | chemical_formula_ref = | chemical_formula_comment =
E.g.
| C=2 | H=6 | O=1 | charge=2-
gives
- Formula C2H6O2−
This is called the empirical form, the most simple form. Entered this way, the elements are ordered in the Hill notation order: When C is present, CxHy in front and the others alphabetically Ar ... Zr. When a molecular formula or structural formula is known, that one should be entered in |chemical_formula= (consider using {{Chem}}).
You can provide the chemical formula as fixed
| chemical_formula = | chemical_formula_ref = | chemical_formula_comment =
todo: example
- Molar mass
When the chemical formula is entered as |C=2 |O=1 |H=6, the molar mass is calculated and presented. This value can be overwritten by using |molecular_weight= (sic). For more information, see {{Chem molar mass}}.
Other chemical data
[uredi kodo]Additional chemical data fields are SMILES and standard InChI (optionally oncluding a comment and standard InChIKey).
| SMILES = | StdInChI = | StdInChI_comment = | StdInChIKey =
Physical data
[uredi kodo]This is an entirely optional section, and for most drugs is not helpful to the wider readership. Only include if information of particular interest for the drug as to its chemical propersites (e.g. in its manufacture or as an important chemical in its own right, e.g. Aspirin). If any of the following optional parameters are defined then a new section header of 'Physical data' is shown.
| density = | melting_point = | boiling_point = | solubility = | specific_rotation = | sec_combustion =
The template will add the following to the numeric values provided:
- Density - added 'g/cm3'
- Melting or Boiling points - added '°C' along with calculated converted value in °F.
- Solubility - added 'mg/mL (20 °C)'
Hence:
| melting_point = 100
gives:
- Melting point 100 °C (212 °F)
In addition, where the melting point occurs over a range of temperatures, use melting_high for the upper value.
Hence:
| melting_point = 100 | melting_high = 104
gives:
- Melting point 100–104 °C (212–219 °F)
Comments can be added to the melting and boiling point entries using melting_notes and boiling_notes.
Hence:
| boiling_point = 100 | boiling_notes = (sublimes)
gives:
- Boiling point 100 °C (212 °F) (sublimes)
Miscellaneous
[uredi kodo]English variant spellings (ENGVAR)
[uredi kodo]The word "License/Licence" can be spelled two ways, depending on the regional language. By MOS ENGVAR, the article defines the spelling to be used (think en-US or en-UK).
The default spelling in the template is en-US: "LicenSe". Setting |engvar=en-AU, en-CA, en-EI, en-NZ, en-UK spells "LicenCe".
Section overview by |type= options
[uredi kodo]A |type= uses some sectionsheader:
| type=mab | type=vaccine | type=combo | type=
- Listed in kat:Učinkovine po tipu
Infopolje Učinkovina razdelki
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
TemplateData
[uredi kodo]TemplateData
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
This infobox provides information over-the-counter and prescription-only drugs. It can be used for single drugs, combination products, monoclonal antibodies and vaccines.
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||