Ogled vira Predloga:Chembox/testniprimeri12

{{Template:Chembox/testniprimeri/navbox|state=uncollapsed}}
* To test: ''each'' subtemplate must be set to /peskovnik in every test-instance (or every article). There is no single point to switch all to /peskovnik. <code><nowiki>
|Section8={{Chembox Hazard/peskovnik|...}}</nowiki></code>

__TOC__

==Demo 1 Magnesium sulfate==
{{purge}}  [[Magnesium sulfate]] (not an exact copy)
<div style="float:left;">
{{chembox/peskovnik
|
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476997098
| Name = Magnesium sulfate
| ImageFile = Magnesium sulfate anhydrous.jpg
| ImageSize = 200px
| ImageCaption = Anhydrous magnesium sulfate
| ImageFile2 = Magnesium sulfate.JPG
| ImageSize2 = 200px
| ImageCaption2 = [[Epsomite]] (heptahydrate)
| IUPACName = Magnesium sulfate
| OtherNames = Epsom salt (heptahydrate)<br /> English salt<br/>Bitter salts
|Section1={{Chembox Identifiers/peskovnik
| Abbreviations = abbr
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ML30MJ2U7I
| UNII1 = ML30MJ2U7I
| UNII2 = ML30MJ2U7I
| UNII3 = ML30MJ2U7I
| UNII4 = ML30MJ2U7I
| UNII5 = ML30MJ2U7I
| UNIIs = sss
| UNIIOther = OtherUNII
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200456
| ChEMBL1 = 1111111
| ChEMBL2 = 5555552
| ChEMBL3 = 5555553
| ChEMBL4 = 5555554
| ChEMBL5 = 5555555
| ChEMBLs = lotsonos
| ChEMBLOther = blablaother
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00653
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32599
| SMILES = [Mg+1].[O-]S([O-])(=O)=O
| SMILES1 = [Mg+2].[O-]S([O-])(=O)=1
| SMILES2 = [Mg+2].[O-]S([O-])(=O)=O2
| SMILES3 = [Mg+2].[O-]S([O-])(=O)=O3
| SMILES4 = [Mg+2].[O-]S([O-])(=O)=O4
| SMILES5 = [Mg+2].[O-]S([O-])(=O)=O5
| SMILESs = sssssss ssssssssss
| SMILESOther = asoeut puioewgr piu
| StdInChI = 1S/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = STDNNHWWHGAXBCP-UHFFFAOYSA-S
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChI1 = 1S/C58H95N15O15/c1-12-28(5)42(70-49(79)37(61-11)23-34-19-17-16-18-20-34)53(83)67-39(26-74)51(81)65-36(21-22-41(59)76)48(78)69-44(30(7)14-3)55(85)71-43(29(6)13-2)54(84)68-40(27-75)52(82)73-46-33(10)88-57(87)45(31(8)15-4)72-50(80)38(24-35-25-62-58(60)64-35)66-47(77)32(9)63-56(46)86/h16-20,28-33,35-40,42-46,61,74-75H,12-15,21-27H2,1-11H3,(H2,59,76)(H,63,86)(H,65,81)(H,66,77)(H,67,83)(H,68,84)(H,69,78)(H,70,79)(H,71,85)(H,72,80)(H,73,82)(H3,60,62,64)/t28-,29-,30-,31-,32-,33-,35-,36+,37+,38-,39-,40-,42-,43-,44+,45-,46+/m1/s1
| InChI2 = 2/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChI3 = 3/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChI4 = 4/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChI5 = 5/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChIs = 1sssssssssssssss
| InChIOther = Oooooo
| InChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = CSNNHWWHGAXBCP-UHFFFAOYSA-L
| InChIKey1 = K1NNHWWHGAXBCP-UHFFFAOYSA-L1
| InChIKey2 = K2NNHWWHGAXBCP-UHFFFAOYSA-L2
| InChIKey3 = CSNNHWWHGAXBCP-UHFFFAOYSA-L3
| InChIKey4 = CSNNHWWHGAXBCP-UHFFFAOYSA-L4
| InChIKey5 = CSNNHWWHGAXBCP-UHFFFAOYSA-L5
| InChIKeys = ssssss
| InChIKeyOther = Othoooooooo
| CASNo = 7487-88-9
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 14168-73-1
| CASNo1_Comment = (monohydrate)
| CASNo2 = 24378-31-2
| CASNo2_Comment = (tetrahydrate)
| CASNo3 = 15553-21-6
| CASNo3_Comment = (pentahydrate)
| CASNo4 = 13778-97-7
| CASNo4_Comment = (hexahydrate)
| CASNo4_Ref = {{cascite|correct|CAS}}
| CASNo5 = 10034-99-8
| CASNo5_Comment = (heptahydrate)
| CASNoOther = Also: 199999-99-9 
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22515
| PubChem = 24083
| EINECS =
| RTECS = OM4500000
| ATCCode_prefix = A06
| ATCCode_suffix = AD04
| ATC_Supplemental = {{ATC|A12|CC02}} {{ATC|B05|XA05}} {{ATC|D11|AX05}} {{ATC|V04|CC02}}
 }}
|Section2={{Chembox Properties/peskovnik
| Formula = MgSO<sub>4</sub>
| Appearance = white crystalline solid
| Odor = odorless
| Density = 2.66 g/cm<sup>3</sup> (anhydrous) <br /> 2.445 g/cm<sup>3</sup> (monohydrate) <br /> 1.68 g/cm<sup>3</sup> (heptahydrate)<br /> 1.512 g/cm<sup>3</sup> (11-hydrate)
| MolarMass = 120.366 g/mol (anhydrous)<br/>138.38 g/mol (monohydrate)<br />174.41 g/mol (trihydrate)<br />210.44 g/mol (pentahydrate)<br />228.46 g/mol (hexahydrate)<br />246.47 g/mol (heptahydrate)
| Solubility = ''anhydrous'' <br /> 26.9 g/100 mL (0 °C) <br /> 25.5 g/100 mL (20 °C) <br> 50.2 g/100 mL (100 °C) <hr> ''heptahydrate'' <br /> 71 g/100 mL (20 °C)
| SolubleOther = 1.16 g/100 mL (18 °C, [[ether]]) <br /> slightly soluble in [[alcohol]], [[glycerol]] <br /> insoluble in [[acetone]]
| MeltingPt = anhydrous decomposes at&nbsp;1,124&nbsp;°C<br />monohydrate decomposes at&nbsp;200&nbsp;°C<br />heptahydrate decomposes at&nbsp;150&nbsp;°C<br />undecahydrate decomposes at&nbsp;2&nbsp;°C
| RefractIndex = 1.523 (monohydrate) <br /> 1.433 (heptahydrate)
 }}
|Section3={{Chembox Structure/peskovnik
| Coordination =
| CrystalStruct = [[monoclinic]] (hydrate)
 }}
|Section7={{Chembox Hazards/peskovnik
| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/m0234.htm External MSDS]
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
| FlashPtF = 100
| FlashPt_ref = <ref>abc</ref>
 }}
|Section8={{Chembox Related/peskovnik
| OtherCations = [[Beryllium sulfate]]<br/>[[Calcium sulfate]]<br/>[[Strontium sulfate]]<br/>[[Barium sulfate]]
| OtherCompounds = 
 }}
}}
</div><!-- ----- ----- ----- ----- ----- ----- ----- ----- ----- -----
 ----- ----- -->
<div style="float:right;">
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476997098
| Name = Magnesium sulfate
| ImageFile = Magnesium sulfate anhydrous.jpg
| ImageSize = 200px
| ImageCaption = Anhydrous magnesium sulfate
| ImageFile2 = Magnesium sulfate.JPG
| ImageSize2 = 200px
| ImageCaption2 = [[Epsomite]] (heptahydrate)
| IUPACName = Magnesium sulfate
| OtherNames = Epsom salt (heptahydrate)<br /> English salt<br/>Bitter salts
|Section1={{Chembox Identifiers
| Abbreviations = abbr
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ML30MJ2U7I
| UNII1 = ML30MJ2U7I
| UNII2 = ML30MJ2U7I
| UNII3 = ML30MJ2U7I
| UNII4 = ML30MJ2U7I
| UNII5 = ML30MJ2U7I
| UNIIs = sss
| UNIIOther = OtherUNII
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200456
| ChEMBL1 = 1111111
| ChEMBL2 = 5555552
| ChEMBL3 = 5555553
| ChEMBL4 = 5555554
| ChEMBL5 = 5555555
| ChEMBLs = lotsonos
| ChEMBLOther = blablaother
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00653
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32599
| SMILES = [Mg+1].[O-]S([O-])(=O)=O
| SMILES1 = [Mg+2].[O-]S([O-])(=O)=1
| SMILES2 = [Mg+2].[O-]S([O-])(=O)=O2
| SMILES3 = [Mg+2].[O-]S([O-])(=O)=O3
| SMILES4 = [Mg+2].[O-]S([O-])(=O)=O4
| SMILES5 = [Mg+2].[O-]S([O-])(=O)=O5
| SMILESs = sssssss ssssssssss
| SMILESOther = asoeut puioewgr piu
| StdInChI = 1S/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = STDNNHWWHGAXBCP-UHFFFAOYSA-S
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChI1 = 1S/C58H95N15O15/c1-12-28(5)42(70-49(79)37(61-11)23-34-19-17-16-18-20-34)53(83)67-39(26-74)51(81)65-36(21-22-41(59)76)48(78)69-44(30(7)14-3)<!--55(85)71-43(29(6)13-2)54(84)68-40(27-75)52(82)73-46-33(10)88-57(87)45(31(8)15-4)72-50(80)38(24-35-25-62-58(60)64-35)66-47(77)32(9)63-56(46)86/h16-20,28-33,35-40,42-46,61,74-75H,12-15,21-27H2,1-11H3,(H2,59,76)(H,63,86)(H,65,81)(H,66,77)(H,67,83)(H,68,84)(H,69,78)(H,70,79)(H,71,85)(H,72,80)(H,73,82)(H3,60,62,64)/t28-,29-,30-,31-,32-,33-,35-,36+,37+,38-,39-,40-,42-,43-,44+,45-,46+/m1/s1-->
| InChI2 = 2/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChI3 = 3/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChI4 = 4/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChI5 = 5/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChIs = 1sssssssssssssss
| InChIOther = Oooooo
| InChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = CSNNHWWHGAXBCP-UHFFFAOYSA-L
| InChIKey1 = K1NNHWWHGAXBCP-UHFFFAOYSA-L1
| InChIKey2 = K2NNHWWHGAXBCP-UHFFFAOYSA-L2
| InChIKey3 = CSNNHWWHGAXBCP-UHFFFAOYSA-L3
| InChIKey4 = CSNNHWWHGAXBCP-UHFFFAOYSA-L4
| InChIKey5 = CSNNHWWHGAXBCP-UHFFFAOYSA-L5
| InChIKeys = ssssss
| InChIKeyOther = Othoooooooo
| CASNo = 7487-88-9
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 14168-73-1
| CASNo1_Comment = (monohydrate)
| CASNo2 = 24378-31-2
| CASNo2_Comment = (tetrahydrate)
| CASNo3 = 15553-21-6
| CASNo3_Comment = (pentahydrate)
| CASNo4 = 13778-97-7
| CASNo4_Comment = (hexahydrate)
| CASNo4_Ref = {{cascite|correct|CAS}}
| CASNo5 = 10034-99-8
| CASNo5_Comment = (heptahydrate)
| CASNoOther = Also: 199999-99-9 
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22515
| PubChem = 24083
| EINECS =
| RTECS = OM4500000
| ATCCode_prefix = A06
| ATCCode_suffix = AD04
| ATC_Supplemental = {{ATC|A12|CC02}} {{ATC|B05|XA05}} {{ATC|D11|AX05}} {{ATC|V04|CC02}}
 }}
|Section2={{Chembox Properties
| Formula = MgSO<sub>4</sub>
| Appearance = white crystalline solid
| Odor = odorless
| Density = 2.66 g/cm<sup>3</sup> (anhydrous) <br /> 2.445 g/cm<sup>3</sup> (monohydrate) <br /> 1.68 g/cm<sup>3</sup> (heptahydrate)<br /> 1.512 g/cm<sup>3</sup> (11-hydrate)
| MolarMass = 120.366 g/mol (anhydrous)<br/>138.38 g/mol (monohydrate)<br />174.41 g/mol (trihydrate)<br />210.44 g/mol (pentahydrate)<br />228.46 g/mol (hexahydrate)<br />246.47 g/mol (heptahydrate)
| Solubility = ''anhydrous'' <br /> 26.9 g/100 mL (0 °C) <br /> 25.5 g/100 mL (20 °C) <br> 50.2 g/100 mL (100 °C) <hr> ''heptahydrate'' <br /> 71 g/100 mL (20 °C)
| SolubleOther = 1.16 g/100 mL (18 °C, [[ether]]) <br /> slightly soluble in [[alcohol]], [[glycerol]] <br /> insoluble in [[acetone]]
| MeltingPt = anhydrous decomposes at&nbsp;1,124&nbsp;°C<br />monohydrate decomposes at&nbsp;200&nbsp;°C<br />heptahydrate decomposes at&nbsp;150&nbsp;°C<br />undecahydrate decomposes at&nbsp;2&nbsp;°C
| RefractIndex = 1.523 (monohydrate) <br /> 1.433 (heptahydrate)
 }}
|Section3={{Chembox Structure
| Coordination =
| CrystalStruct = [[monoclinic]] (hydrate)
 }}
|Section7={{Chembox Hazards
| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/m0234.htm External MSDS]
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
| FlashPtF = 100
| FlashPt_ref = <ref>abc</ref>

 }}
|Section8={{Chembox Related
| OtherCations = [[Beryllium sulfate]]<br/>[[Calcium sulfate]]<br/>[[Strontium sulfate]]<br/>[[Barium sulfate]]
| OtherCompounds = }}}}
</div>
{{clear}}

==Demo 2==
distorted
<div style="float:left;">
{{chembox/peskovnik
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476997098
| Name = Magnesium sulfate
| IUPACName = Magnesium sulfate
| OtherNames = Epsom salt (heptahydrate)<br /> English salt<br/>Bitter salts
|Section1={{Chembox Identifiers/peskovnik
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ML30MJ2U7I
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200456
| InChI = 1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChIKey = CSNNHWWHGAXBCP-NUQVWONBAQ
| InChI2 = InChI=1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChIKey2 = 222| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00653
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32599
| SMILES = [Mg+2].[O-]S([O-])(=O)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CSNNHWWHGAXBCP-UHFFFAOYSA-L

| CASNoOther = Also: 133-33-3 (CASNoOther test)
<!--
| CASNo = 7487-88-9
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 14168-73-1
| CASNo1_Comment = (monohydrate)
| CASNo2 = 24378-31-2
| CASNo2_Comment = (tetrahydrate)
| CASNo3 = 15553-21-6
| CASNo3_Comment = (pentahydrate)
| CASNo4 = 13778-97-7
| CASNo4_Comment = (hexahydrate)
| CASNo4_Ref = {{cascite|correct|CAS}}
| CASNo5 = 10034-99-8
| CASNo5_Comment = (heptahydrate)
| CASNoOther = Also: 199999-99-9  (CASNoOther test)
-->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22515
| PubChem = 24083
| EINECS =
| RTECS = OM4500000
| ATCCode_prefix = A06
| ATCCode_suffix = AD04
| ATC_Supplemental = {{ATC|A12|CC02}} {{ATC|B05|XA05}} {{ATC|D11|AX05}} {{ATC|V04|CC02}}
 }}
|Section2={{Chembox Properties/peskovnik
| Formula = MgSO<sub>4</sub>
| Appearance = white crystalline solid
| Odor = odorless
| Density = 2.66 g/cm<sup>3</sup> (anhydrous) <br /> 2.445 g/cm<sup>3</sup> (monohydrate) <br /> 1.68 g/cm<sup>3</sup> (heptahydrate)<br /> 1.512 g/cm<sup>3</sup> (11-hydrate)
| MolarMass = 120.366 g/mol (anhydrous)<br/>138.38 g/mol (monohydrate)<br />174.41 g/mol (trihydrate)<br />210.44 g/mol (pentahydrate)<br />228.46 g/mol (hexahydrate)<br />246.47 g/mol (heptahydrate)
| Solubility = ''anhydrous'' <br /> 26.9 g/100 mL (0 °C) <br /> 25.5 g/100 mL (20 °C) <br> 50.2 g/100 mL (100 °C) <hr> ''heptahydrate'' <br /> 71 g/100 mL (20 °C)
| SolubleOther = 1.16 g/100 mL (18 °C, [[ether]]) <br /> slightly soluble in [[alcohol]], [[glycerol]] <br /> insoluble in [[acetone]]
| MeltingPt = anhydrous decomposes at&nbsp;1,124&nbsp;°C<br />monohydrate decomposes at&nbsp;200&nbsp;°C<br />heptahydrate decomposes at&nbsp;150&nbsp;°C<br />undecahydrate decomposes at&nbsp;2&nbsp;°C
| RefractIndex = 1.523 (monohydrate) <br /> 1.433 (heptahydrate)
 }}
|Section3={{Chembox Structure/peskovnik
| Coordination =
| CrystalStruct = [[monoclinic]] (hydrate)
 }}
|Section7={{Chembox Hazards/peskovnik
| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/m0234.htm External MSDS]
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
 }}
|Section8={{Chembox Related/peskovnik
| OtherCations = [[Beryllium sulfate]]<br/>[[Calcium sulfate]]<br/>[[Strontium sulfate]]<br/>[[Barium sulfate]]
| OtherCompounds = 
 }}
}}
</div><!--
 ----- ----- -->
<div style="float:right;">
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476997098
| Name = Magnesium sulfate
| IUPACName = Magnesium sulfate
| OtherNames = Epsom salt (heptahydrate)<br /> English salt<br/>Bitter salts
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ML30MJ2U7I
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200456
| InChI = 1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChIKey = CSNNHWWHGAXBCP-NUQVWONBAQ
| InChI2 = InChI=1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChIKey2 = 222
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00653
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32599
| SMILES = [Mg+2].[O-]S([O-])(=O)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CSNNHWWHGAXBCP-UHFFFAOYSA-L

| CASNoOther = Also: 133-33-3 (CASNoOther test)
<!--
| CASNo = 7487-88-9
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 14168-73-1
| CASNo1_Comment = (monohydrate)
| CASNo2 = 24378-31-2
| CASNo2_Comment = (tetrahydrate)
| CASNo3 = 15553-21-6
| CASNo3_Comment = (pentahydrate)
| CASNo4 = 13778-97-7
| CASNo4_Comment = (hexahydrate)
| CASNo4_Ref = {{cascite|correct|CAS}}
| CASNo5 = 10034-99-8
| CASNo5_Comment = (heptahydrate)
| CASNoOther = Also: 199999-99-9  (CASNoOther test)
-->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22515
| PubChem = 24083
| EINECS =
| RTECS = OM4500000
| ATCCode_prefix = A06
| ATCCode_suffix = AD04
| ATC_Supplemental = {{ATC|A12|CC02}} {{ATC|B05|XA05}} {{ATC|D11|AX05}} {{ATC|V04|CC02}}
 }}
|Section2={{Chembox Properties
| Formula = MgSO<sub>4</sub>
| Appearance = white crystalline solid
| Odor = odorless
| Density = 2.66 g/cm<sup>3</sup> (anhydrous) <br /> 2.445 g/cm<sup>3</sup> (monohydrate) <br /> 1.68 g/cm<sup>3</sup> (heptahydrate)<br /> 1.512 g/cm<sup>3</sup> (11-hydrate)
| MolarMass = 120.366 g/mol (anhydrous)<br/>138.38 g/mol (monohydrate)<br />174.41 g/mol (trihydrate)<br />210.44 g/mol (pentahydrate)<br />228.46 g/mol (hexahydrate)<br />246.47 g/mol (heptahydrate)
| Solubility = ''anhydrous'' <br /> 26.9 g/100 mL (0 °C) <br /> 25.5 g/100 mL (20 °C) <br> 50.2 g/100 mL (100 °C) <hr> ''heptahydrate'' <br /> 71 g/100 mL (20 °C)
| SolubleOther = 1.16 g/100 mL (18 °C, [[ether]]) <br /> slightly soluble in [[alcohol]], [[glycerol]] <br /> insoluble in [[acetone]]
| MeltingPt = anhydrous decomposes at&nbsp;1,124&nbsp;°C<br />monohydrate decomposes at&nbsp;200&nbsp;°C<br />heptahydrate decomposes at&nbsp;150&nbsp;°C<br />undecahydrate decomposes at&nbsp;2&nbsp;°C
| RefractIndex = 1.523 (monohydrate) <br /> 1.433 (heptahydrate)
 }}
|Section3={{Chembox Structure
| Coordination =
| CrystalStruct = [[monoclinic]] (hydrate)
 }}
|Section7={{Chembox Hazards
| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/m0234.htm External MSDS]
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
 }}
|Section8={{Chembox Related
| OtherCations = [[Beryllium sulfate]]<br/>[[Calcium sulfate]]<br/>[[Strontium sulfate]]<br/>[[Barium sulfate]]
| OtherCompounds = 
 }}
}}</div>
{{clear}}

==Demo 3==
{{purge}} cat checks Other, break
<div style="float:left;">
{{chembox/peskovnik
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476997098
| Name = Magnesium sulfate
| IUPACName = Magnesium sulfate
| OtherNames = Epsom salt (heptahydrate)<br /> English salt<br/>Bitter salts
|Section1={{Chembox Identifiers/peskovnik
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ML30MJ2U7I
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200456
| InChI = 1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChIKey = CSNNHWWHGAXBCP-NUQVWONBAQ
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00653
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32599
| SMILES = [Mg+2].[O-]S([O-])(=O)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CSNNHWWHGAXBCP-UHFFFAOYSA-L
| CASNo = 7487-88-9
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 14168-73-1
| CASNo1_Comment = (monohydrate)
| CASNo2 = 24378-31-2
| CASNo2_Comment = (tetrahydrate)
| CASNo3 = 15553-21-6
| CASNo3_Comment = (pentahydrate)
| CASNo4 = 13778-97-7
| CASNo4_Comment = <br/>(hexahydrate)
| CASNo4_Ref = {{cascite|correct|CAS}}
| CASNo5 = 10034-99-8
| CASNo5_Comment = (heptahydrate)

| CASNoOther = Also: 199999-99-9  (CASNoOther test)
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22515
| PubChem = 24083
| EINECS =
| RTECS = OM4500000
| ATCCode_prefix = A06
| ATCCode_suffix = AD04
| ATC_Supplemental = {{ATC|A12|CC02}} {{ATC|B05|XA05}} {{ATC|D11|AX05}} {{ATC|V04|CC02}}
 }}
|Section2={{Chembox Properties/peskovnik
| Formula = MgSO<sub>4</sub>
| Appearance = white crystalline solid
| Odor = odorless
| Density = 2.66 g/cm<sup>3</sup> (anhydrous) <br /> 2.445 g/cm<sup>3</sup> (monohydrate) <br /> 1.68 g/cm<sup>3</sup> (heptahydrate)<br /> 1.512 g/cm<sup>3</sup> (11-hydrate)
| MolarMass = 120.366 g/mol (anhydrous)<br/>138.38 g/mol (monohydrate)<br />174.41 g/mol (trihydrate)<br />210.44 g/mol (pentahydrate)<br />228.46 g/mol (hexahydrate)<br />246.47 g/mol (heptahydrate)
| Solubility = ''anhydrous'' <br /> 26.9 g/100 mL (0 °C) <br /> 25.5 g/100 mL (20 °C) <br> 50.2 g/100 mL (100 °C) <hr> ''heptahydrate'' <br /> 71 g/100 mL (20 °C)
| SolubleOther = 1.16 g/100 mL (18 °C, [[ether]]) <br /> slightly soluble in [[alcohol]], [[glycerol]] <br /> insoluble in [[acetone]]
| MeltingPt = anhydrous decomposes at&nbsp;1,124&nbsp;°C<br />monohydrate decomposes at&nbsp;200&nbsp;°C<br />heptahydrate decomposes at&nbsp;150&nbsp;°C<br />undecahydrate decomposes at&nbsp;2&nbsp;°C
| RefractIndex = 1.523 (monohydrate) <br /> 1.433 (heptahydrate)
 }}
|Section3={{Chembox Structure/peskovnik
| Coordination =
| CrystalStruct = [[monoclinic]] (hydrate)
 }}
|Section7={{Chembox Hazards/peskovnik
| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/m0234.htm External MSDS]
| AutoignitionPt = A-ignit
| AutoignitionPtC = 50
| NFPA-F = 1
| NFPA-S = W
 }}
|Section8={{Chembox Related/peskovnik
| OtherCations = [[Beryllium sulfate]]<br/>[[Calcium sulfate]]<br/>[[Strontium sulfate]]<br/>[[Barium sulfate]]
| OtherCompounds = 
 }}
}}
</div><!--
 ----- ----- -->
<div style="float:right;">
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476997098
| Name = Magnesium sulfate
| IUPACName = Magnesium sulfate
| OtherNames = Epsom salt (heptahydrate)<br /> English salt<br/>Bitter salts
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ML30MJ2U7I
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200456
| InChI = 1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| InChIKey = CSNNHWWHGAXBCP-NUQVWONBAQ
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00653
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32599
| SMILES = [Mg+2].[O-]S([O-])(=O)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CSNNHWWHGAXBCP-UHFFFAOYSA-L
| CASNo = 7487-88-9
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 14168-73-1
| CASNo1_Comment = (monohydrate)
| CASNo2 = 24378-31-2
| CASNo2_Comment = (tetrahydrate)
| CASNo3 = 15553-21-6
| CASNo3_Comment = (pentahydrate)
| CASNo4 = 13778-97-7
| CASNo4_Comment = <br/>(hexahydrate)
| CASNo4_Ref = {{cascite|correct|CAS}}
| CASNo5 = 10034-99-8
| CASNo5_Comment = (heptahydrate)

| CASNoOther = Also: 199999-99-9  (CASNoOther test)
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22515
| PubChem = 24083
| EINECS =
| RTECS = OM4500000
| ATCCode_prefix = A06
| ATCCode_suffix = AD04
| ATC_Supplemental = {{ATC|A12|CC02}} {{ATC|B05|XA05}} {{ATC|D11|AX05}} {{ATC|V04|CC02}}
 }}
|Section2={{Chembox Properties
| Formula = MgSO<sub>4</sub>
| Appearance = white crystalline solid
| Odor = odorless
| Density = 2.66 g/cm<sup>3</sup> (anhydrous) <br /> 2.445 g/cm<sup>3</sup> (monohydrate) <br /> 1.68 g/cm<sup>3</sup> (heptahydrate)<br /> 1.512 g/cm<sup>3</sup> (11-hydrate)
| MolarMass = 120.366 g/mol (anhydrous)<br/>138.38 g/mol (monohydrate)<br />174.41 g/mol (trihydrate)<br />210.44 g/mol (pentahydrate)<br />228.46 g/mol (hexahydrate)<br />246.47 g/mol (heptahydrate)
| Solubility = ''anhydrous'' <br /> 26.9 g/100 mL (0 °C) <br /> 25.5 g/100 mL (20 °C) <br> 50.2 g/100 mL (100 °C) <hr> ''heptahydrate'' <br /> 71 g/100 mL (20 °C)
| SolubleOther = 1.16 g/100 mL (18 °C, [[ether]]) <br /> slightly soluble in [[alcohol]], [[glycerol]] <br /> insoluble in [[acetone]]
| MeltingPt = anhydrous decomposes at&nbsp;1,124&nbsp;°C<br />monohydrate decomposes at&nbsp;200&nbsp;°C<br />heptahydrate decomposes at&nbsp;150&nbsp;°C<br />undecahydrate decomposes at&nbsp;2&nbsp;°C
| RefractIndex = 1.523 (monohydrate) <br /> 1.433 (heptahydrate)
 }}
|Section3={{Chembox Structure
| Coordination =
| CrystalStruct = [[monoclinic]] (hydrate)
 }}
|Section7={{Chembox Hazards
| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/m0234.htm External MSDS]
| AutoignitionPt = A-ignit
| AutoignitionPtC = 50
| NFPA-F = 1
| NFPA-S = W 
}}
|Section8={{Chembox Related
| OtherCations = [[Beryllium sulfate]]<br/>[[Calcium sulfate]]<br/>[[Strontium sulfate]]<br/>[[Barium sulfate]]
| OtherCompounds = 
 }}
}}</div>
{{clear}}

==Ammonia==
{{purge}}
<div style="float=right;">
{{Chembox
| Name=[[Ammonia]]
| Watchedfields = changed
| verifiedrevid = 464364488
| ImageFile1 = Ammonia-dimensions-from-Greenwood&Earnshaw-2D.png
| ImageName1 = Stereo structural formula of the ammonia molecule
| ImageFileL1 = Ammonia-3D-balls-A.png
| ImageNameL1 = Ball-and-stick model of the ammonia molecule
| ImageFileR1 = Ammonia-3D-vdW.png
| ImageNameR1 = Space-filling model of the ammonia molecule
| IUPACName = Azane
| OtherNames = Hydrogen nitride<br />
Trihydrogen nitride<br />
Nitro-Sil
|Section1={{Chembox Identifiers
| InChI = 1/H3N/h1H3
| InChIKey = QGZKDVFQNNGYKY-UHFFFAOYAF
| CASNo = 7664-41-7
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 222
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1160819
| ChemSpiderID = 217
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = 5138Q19F1X
| UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 231-635-3
| UNNumber = 1005
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02916
| MeSHName = Ammonia
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16134
| RTECS = BO0875000
| SMILES = N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/H3N/h1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QGZKDVFQNNGYKY-UHFFFAOYSA-N
| Beilstein = 3587154
| Gmelin = 79
| 3DMet = B00004}}
|Section2={{Chembox Properties
| Formula = NH<sub>3</sub>
| MolarMass = 17.031 g/mol
| Appearance = Colourless gas
| Odor = strong pungent odor
| Density = 0.86&nbsp;kg/m<sup>3</sup> (1.013 bar at boiling point)<br />
0.769 &nbsp;kg/m<sup>3</sup> (STP)<ref>http://www.engineeringtoolbox.com/gas-density-d_158.html</ref><br />
0.73&nbsp;kg/m<sup>3</sup> (1.013 bar at 15&nbsp;°C)<br />
681.9&nbsp;kg/m<sup>3</sup> at −33.3&nbsp;°C (liquid)<ref>{{navedi knjigo|url=https://books.google.com/?id=qPGzhL3Y50YC&pg=PA132|page=132|title=Systematic Inorganic Chemistry|author=Yost, Don M.|chapter=Ammonia and Liquid Ammonia Solutions|publisher=READ BOOKS|year=2007|isbn=1-4067-7302-6}}</ref><br />
817&nbsp;kg/m<sup>3</sup> at −80&nbsp;°C (transparent solid)<ref>{{cite journal|doi=10.1080/00337577508240819|title=On crystalline character of transparent solid ammonia|year=1975|author=Blum, Alexander|journal=Radiation Effects and Defects in Solids|volume=24|issue=4|page=277}}</ref>
| MeltingPtC = −77.73
| BoilingPtC = −33.34
| Solubility = 47% w/w (0&nbsp;°C)<br />31% w/w (25&nbsp;°C)<br />18% w/w (50&nbsp;°C)<ref>{{navedi knjigo|title=The Merck Index: An Encyclopedia of Chemicals, Drugs, and Biologicals|edition=12th|editor-last=Budavari|editor-first=Susan|publisher=Merck|year=1996|isbn=0-911910-12-3}}</ref>
| SolubleOther = soluble in [[chloroform]], [[ether]], [[ethanol]], [[methanol]]
| Solvent =
| pKa = 32.5 (−33&nbsp;°C),<ref>Perrin, D. D., ''Ionisation Constants of Inorganic Acids and Bases in Aqueous Solution''; 2nd Ed., Pergamon Press: Oxford, '''1982'''.</ref> 10.5 (DMSO)
| pKb = 4.75
| RefractIndex = 1.3327
| coViscosity = 0.276 cP (&minus;40 °C)
| VaporPressure = 8573 h Pa
}}
|Section3={{Chembox Structure
| MolShape = [[Trigonal pyramid (chemistry)|Trigonal pyramid]]
| Dipole = 1.42 [[Debye|D]]
| PointGroup = C<sub>3v</sub>
}}
|Section4={{Chembox Thermochemistry
| DeltaHf = −46&nbsp;kJ·mol<sup>−1</sup><ref name=b1>{{navedi knjigo| author = Zumdahl, Steven S.|title =Chemical Principles 6th Ed| publisher = Houghton Mifflin Company| year = 2009| isbn = 0-618-94690-X|page=A22}}</ref>
| Entropy = 193&nbsp;J·mol<sup>−1</sup>·K<sup>−1</sup><ref name=b1/>
 }}
|Section7={{Chembox Hazards
| GHSPictograms = {{GHS04}}{{GHS05}}{{GHS06}}{{GHS09}}<ref name="sigma">{{Sigma-Aldrich|id=294993|name=Ammonia|accessdate=2013-07-20}}</ref>
| HPhrases = {{H-phrases|221|280|314|331|400}}<ref name="sigma" />
| PPhrases = {{P-phrases|210|261|273|280|305+351+338|310}}<ref name="sigma" />
| External MSDS = [http://www.inchem.org/documents/icsc/icsc/eics0414.htm ICSC 0414] (anhydrous)
| EUClass = {{Hazchem T}} {{Hazchem C}} {{Hazchem N}}
| NFPA-H = 3
| NFPA-F = 1
| NFPA-R = 0
| NFPA-S =
| RPhrases = {{R10}}, {{R23}}, {{R34}}, {{R50}}
| SPhrases = {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}}
| FlashPt = flammable gas (''see text'')
| AutoignitionPtC = 651
| ExploLimits = 15–28%
| PEL = 50 ppm (25 ppm [[ACGIH]]- TLV; 35 ppm [[STEL]])
| LD50 = 0.015 mL/kg (human, oral)
}}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations = [[Phosphine]]<br />[[Arsine]]<br />[[Stibine]]
| OtherFunction = [[Hydrazine]]<br />[[Hydrazoic acid]]
| OtherFunction_label = nitrogen hydrides
| OtherCompounds = [[Ammonium hydroxide]]
}}
}}</div>
<!-- ----- ----- ----- ----- ----- ----- ----- ----- ----- ----- 
--><div style="float:left;">
{{chembox/peskovnik
 |Name=[[Ammonia]]
| Watchedfields = changed
| verifiedrevid = 464364488
| ImageFile1 = Ammonia-dimensions-from-Greenwood&Earnshaw-2D.png
| ImageName1 = Stereo structural formula of the ammonia molecule
| ImageFileL1 = Ammonia-3D-balls-A.png
| ImageNameL1 = Ball-and-stick model of the ammonia molecule
| ImageFileR1 = Ammonia-3D-vdW.png
| ImageNameR1 = Space-filling model of the ammonia molecule
| IUPACName = Azane
| OtherNames = Hydrogen nitride<br />
Trihydrogen nitride<br />
Nitro-Sil
|Section1={{Chembox Identifiers/peskovnik
| InChI = 1/H3N/h1H3
| InChIKey = QGZKDVFQNNGYKY-UHFFFAOYAF
| CASNo = 7664-41-7
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 222
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1160819
| ChemSpiderID = 217
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = 5138Q19F1X
| UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 231-635-3
| UNNumber = 1005
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02916
| MeSHName = Ammonia
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16134
| RTECS = BO0875000
| SMILES = N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/H3N/h1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QGZKDVFQNNGYKY-UHFFFAOYSA-N
| Beilstein = 3587154
| Gmelin = 79
| 3DMet = B00004}}
|Section2={{Chembox Properties/peskovnik
| Formula = NH<sub>3</sub>
| MolarMass = 17.031 g/mol
| Appearance = Colourless gas
| Odor = strong pungent odor
| Density = 0.86&nbsp;kg/m<sup>3</sup> (1.013 bar at boiling point)<br />
0.769 &nbsp;kg/m<sup>3</sup> (STP)<ref>http://www.engineeringtoolbox.com/gas-density-d_158.html</ref><br />
0.73&nbsp;kg/m<sup>3</sup> (1.013 bar at 15&nbsp;°C)<br />
681.9&nbsp;kg/m<sup>3</sup> at −33.3&nbsp;°C (liquid)<ref>{{navedi knjigo|url=https://books.google.com/?id=qPGzhL3Y50YC&pg=PA132|page=132|title=Systematic Inorganic Chemistry|author=Yost, Don M.|chapter=Ammonia and Liquid Ammonia Solutions|publisher=READ BOOKS|year=2007|isbn=1-4067-7302-6}}</ref><br />
817&nbsp;kg/m<sup>3</sup> at −80&nbsp;°C (transparent solid)<ref>{{cite journal|doi=10.1080/00337577508240819|title=On crystalline character of transparent solid ammonia|year=1975|author=Blum, Alexander|journal=Radiation Effects and Defects in Solids|volume=24|issue=4|page=277}}</ref>
| MeltingPtC = −77.73
| BoilingPtC = −33.34
| Solubility = 47% w/w (0&nbsp;°C)<br />31% w/w (25&nbsp;°C)<br />18% w/w (50&nbsp;°C)<ref>{{navedi knjigo|title=The Merck Index: An Encyclopedia of Chemicals, Drugs, and Biologicals|edition=12th|editor-last=Budavari|editor-first=Susan|publisher=Merck|year=1996|isbn=0-911910-12-3}}</ref>
| SolubleOther = soluble in [[chloroform]], [[ether]], [[ethanol]], [[methanol]]
| Solvent =
| pKa = 32.5 (−33&nbsp;°C),<ref>Perrin, D. D., ''Ionisation Constants of Inorganic Acids and Bases in Aqueous Solution''; 2nd Ed., Pergamon Press: Oxford, '''1982'''.</ref> 10.5 (DMSO)
| pKb = 4.75
| RefractIndex = 1.3327
| coViscosity = 0.276 cP (&minus;40 °C)
| VaporPressure = 8573 h Pa
}}
|Section3={{Chembox Structure/peskovnik
| MolShape = [[Trigonal pyramid (chemistry)|Trigonal pyramid]]
| Dipole = 1.42 [[Debye|D]]
| PointGroup = C<sub>3v</sub>
}}
|Section4={{Chembox Thermochemistry/peskovnik
| DeltaHf = −46&nbsp;kJ·mol<sup>−1</sup><ref name=b1>{{navedi knjigo| author = Zumdahl, Steven S.|title =Chemical Principles 6th Ed| publisher = Houghton Mifflin Company| year = 2009| isbn = 0-618-94690-X|page=A22}}</ref>
| Entropy = 193&nbsp;J·mol<sup>−1</sup>·K<sup>−1</sup><ref name=b1/>
 }}
|Section7={{Chembox Hazards/peskovnik
| GHSPictograms = {{GHS04}}{{GHS05}}{{GHS06}}{{GHS09}}<ref name="sigma">{{Sigma-Aldrich|id=294993|name=Ammonia|accessdate=2013-07-20}}</ref>
| HPhrases = {{H-phrases|221|280|314|331|400}}<ref name="sigma" />
| PPhrases = {{P-phrases|210|261|273|280|305+351+338|310}}<ref name="sigma" />
| External MSDS = [http://www.inchem.org/documents/icsc/icsc/eics0414.htm ICSC 0414] (anhydrous)
| EUClass = {{Hazchem T}} {{Hazchem C}} {{Hazchem N}}
| NFPA-H = 3
| NFPA-F = 1
| NFPA-R = 0
| NFPA-S =
| RPhrases = {{R10}}, {{R23}}, {{R34}}, {{R50}}
| SPhrases = {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}}
| FlashPt = flammable gas (''see text'')
| AutoignitionPtC = 651
| ExploLimits = 15–28%
| PEL = 50 ppm (25 ppm [[ACGIH]]- TLV; 35 ppm [[STEL]])
| LD50 = 0.015 mL/kg (human, oral)
}}
|Section8={{Chembox Related/peskovnik
| OtherAnions =
| OtherCations = [[Phosphine]]<br />[[Arsine]]<br />[[Stibine]]
| OtherFunction = [[Hydrazine]]<br />[[Hydrazoic acid]]
| OtherFunction_label = nitrogen hydrides
| OtherCompounds = [[Ammonium hydroxide]]
}}
}}</div>{{clear}}

==[[Periodic acid]]==
Uses:
<pre>
| ImageFile2 = &lt;nowiki>Orthoperiodic acid&lt;/nowiki>
</pre>
{{purge}}
<div style="float=right;">
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 464199231
| Name = Periodic acid
| ImageFileL1 = Ortho-Periodsäure.svg
| ImageFileR1 = Orthoperiodic-acid-3D-balls.png
| ImageFile2 = <nowiki>Orthoperiodic acid</nowiki>
| ImageCaption2 = 
| ImageFileL3 = Meta-Periodsäure.svg
| ImageFileR3 = Metaperiodic-acid-3D-balls.png
| ImageFile4 = <nowiki>Metaperiodic acid</nowiki>
| ImageCaption4 = 
| IUPACName = 
| OtherNames = {{unbulleted list|Paraperiodic acid|Iodic(VII) acid|Hydrogen periodate}}
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 10450-60-9
| CASNo_Comment = (orthoperiodic)
| CASNo1 = 13444-71-8
| CASNo1_Comment = (metaperiodic)
| PubChem = 25289
| PubChem_Comment = (orthoperiodic)
| PubChem1 = 65185
| PubChem1_Comment = (metaperiodic)
| ChemSpiderID = 23622
| ChemSpiderID_Comment = (orthoperiodic)
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID1 = 58684
| ChemSpiderID1_Comment = (metaperiodic)
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| SMILES = OI(=O)(O)(O)(O)O
| SMILES_Comment = (orthoperiodic)
| SMILES1 = OI(O)(O)(O)(O)=O
| SMILES1_Comment = (metaperiodic)
| InChI = I=1S/H5IO6/c2-1(3,4,5,6)7/h(H5,2,3,4,5,6,7)
| InChIKey = TWLXDPFBEPBAQB-UHFFFAOYSA-N
| InChI_Comment = (orthoperiodic)
| InChI1 = 1/HIO4/c2-1(3,4)5/h(H,2,3,4,5)
| InChIKey1 = KHIWWQKSHDUIBK-UHFFFAOYAH
| InChI1_Comment = (metaperiodic)
}}
|Section2={{Chembox Properties
| Formula = H<sub>5</sub>IO<sub>6</sub> (orthoperiodic)<BR>HIO<sub>4</sub> (metaperiodic)
| MolarMass = 227.941 g/mol (H<sub>5</sub>IO<sub>6</sub>)<BR>190.91 g/mol (HIO<sub>4</sub>)
| Appearance = Colourless crystals
| Density = 1.4 kg/m<sup>3</sup> (orthoperiodic)
| MeltingPtC = 128.5
| MeltingPt_ref = <ref>{{navedi knjigo|last=Aylett|first=founded by A.F. Holleman ; continued by Egon Wiberg ; translated by Mary Eagleson, William Brewer ; revised by Bernhard J.|title=Inorganic chemistry|year=2001|publisher=Academic Press, W. de Gruyter.|location=San Diego, Calif. : Berlin|isbn=0123526515|page=453|edition=1st English ed., [edited] by Nils Wiberg.}}</ref>
| BoilingPt = 
| SolubleOther = soluble in water, alcohols}}
|Section3={{Chembox Hazards
| ExternalSDS = [http://physchem.ox.ac.uk/MSDS/PE/periodic_acid.html External MSDS]
| EUClass = Oxidizer ('''O'''), Toxic ('''T'''), Corrosive ('''C''')
| RPhrases = {{R23}} {{R24}} {{R25}} {{R34}} {{R41}}
| NFPA-H = 3
| NFPA-F = 0
| NFPA-R = 0
| NFPA-S = OX
| FlashPt = 
| AutoignitionPt = }}
|Section4={{Chembox Related
| OtherFunction_label = 
| OtherAnions = {{unbulleted list|[[Perchloric acid]] HClO<sub>4</sub>|[[Perbromic acid]] HBrO<sub>4</sub>|[[Permanganic acid]] HMnO<sub>4</sub>|[[Telluric acid]] Te(OH)<sub>6</sub>|[[perxenic acid]] Xe(OH)<sub>6</sub>}}
| OtherCations = {{unbulleted list|[[Sodium periodate]]|[[Potassium periodate]]}}
| OtherCompounds = 
| OtherFunction = 
 }}
}}</div>
<!-- ----- ----- ----- ----- ----- ----- ----- ----- ----- -----
--><div style="float:left;">
{{chembox/peskovnik
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 464199231
| Name = Periodic acid
| ImageFileL1 = Ortho-Periodsäure.svg
| ImageFileR1 = Orthoperiodic-acid-3D-balls.png
| ImageFile2 = <nowiki>Orthoperiodic acid</nowiki>
| ImageCaption2 = 
| ImageFileL3 = Meta-Periodsäure.svg
| ImageFileR3 = Metaperiodic-acid-3D-balls.png
| ImageFile4 = <nowiki>Metaperiodic acid</nowiki>
| ImageCaption4 = 
| IUPACName = 
| OtherNames = {{unbulleted list|Paraperiodic acid|Iodic(VII) acid|Hydrogen periodate}}
|Section1={{Chembox Identifiers/peskovnik
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 10450-60-9
| CASNo_Comment = (orthoperiodic)
| CASNo1 = 13444-71-8
| CASNo1_Comment = (metaperiodic)
| PubChem = 25289
| PubChem_Comment = (orthoperiodic)
| PubChem1 = 65185
| PubChem1_Comment = (metaperiodic)
| ChemSpiderID = 23622
| ChemSpiderID_Comment = (orthoperiodic)
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID1 = 58684
| ChemSpiderID1_Comment = (metaperiodic)
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| SMILES = OI(=O)(O)(O)(O)O
| SMILES_Comment = (orthoperiodic)
| SMILES1 = OI(O)(O)(O)(O)=O
| SMILES1_Comment = (metaperiodic)
| InChI = I=1S/H5IO6/c2-1(3,4,5,6)7/h(H5,2,3,4,5,6,7)
| InChIKey = TWLXDPFBEPBAQB-UHFFFAOYSA-N
| InChI_Comment = (orthoperiodic)
| InChI1 = 1/HIO4/c2-1(3,4)5/h(H,2,3,4,5)
| InChIKey1 = KHIWWQKSHDUIBK-UHFFFAOYAH
| InChI1_Comment = (metaperiodic)
}}
|Section2={{Chembox Properties/peskovnik
| Formula = H<sub>5</sub>IO<sub>6</sub> (orthoperiodic)<BR>HIO<sub>4</sub> (metaperiodic)
| MolarMass = 227.941 g/mol (H<sub>5</sub>IO<sub>6</sub>)<BR>190.91 g/mol (HIO<sub>4</sub>)
| Appearance = Colourless crystals
| Density = 1.4 kg/m<sup>3</sup> (orthoperiodic)
| MeltingPtC = 128.5
| MeltingPt_ref = <ref>{{navedi knjigo|last=Aylett|first=founded by A.F. Holleman ; continued by Egon Wiberg ; translated by Mary Eagleson, William Brewer ; revised by Bernhard J.|title=Inorganic chemistry|year=2001|publisher=Academic Press, W. de Gruyter.|location=San Diego, Calif. : Berlin|isbn=0123526515|page=453|edition=1st English ed., [edited] by Nils Wiberg.}}</ref>
| BoilingPt = 
| SolubleOther = soluble in water, alcohols}}
|Section3={{Chembox Hazards/peskovnik
| ExternalSDS = [http://physchem.ox.ac.uk/MSDS/PE/periodic_acid.html External MSDS]
| EUClass = Oxidizer ('''O'''), Toxic ('''T'''), Corrosive ('''C''')
| RPhrases = {{R23}} {{R24}} {{R25}} {{R34}} {{R41}}
| NFPA-H = 3
| NFPA-F = 0
| NFPA-R = 0
| NFPA-S = OX
| FlashPt = 
| AutoignitionPt = }}
|Section4={{Chembox Related/peskovnik
| OtherFunction_label = 
| OtherAnions = {{unbulleted list|[[Perchloric acid]] HClO<sub>4</sub>|[[Perbromic acid]] HBrO<sub>4</sub>|[[Permanganic acid]] HMnO<sub>4</sub>|[[Telluric acid]] Te(OH)<sub>6</sub>|[[perxenic acid]] Xe(OH)<sub>6</sub>}}
| OtherCations = {{unbulleted list|[[Sodium periodate]]|[[Potassium periodate]]}}
| OtherCompounds = 
| OtherFunction = 
 }}

}}</div>{{clear}}

==Chloral hydrate (pharma)==
{{purge}}
<div style="float=right;">
{{chembox
| Name=[[Chloral hydrate]]
|Section5={{Chembox Pharmacology
| AdminRoutes = Oral codeine/syrup, rectal [[suppository]]
| Bioavail = well absorbed
| Metabolism = converted to trichloroethanol, hepatic and renal
| HalfLife = 8–10 hours in plasma
| ProteinBound =
| Excretion = bile, feces, urine (various metabolites not unchanged)
| Legal_status =
| Legal_US = Schedule IV
| Legal_UK =
| Legal_AU =
| Legal_CA = Non Controlled in CANADA
| PregCat =
| PregCat_AU =
| PregCat_US = C
  }}
}}</div>
<!-- ----- ----- ----- ----- ----- ----- ----- ----- ----- -----
--><div style="float:left;">
{{chembox/peskovnik
| Name=[[Chloral hydrate]]
|Section5={{Chembox Pharmacology/peskovnik
| AdminRoutes = Oral codeine/syrup, rectal [[suppository]]
| Bioavail = well absorbed
| Metabolism = converted to trichloroethanol, hepatic and renal
| HalfLife = 8–10 hours in plasma
| ProteinBound =
| Excretion = bile, feces, urine (various metabolites not unchanged)
| Legal_status =
| Legal_US = Schedule IV
| Legal_UK =
| Legal_AU =
| Legal_CA = Non Controlled in CANADA
| PregCat =
| PregCat_AU =
| PregCat_US = C
  }}
}}</div>{{clear}}
==Pharma: legal==
{{purge}}
<div style="float=right;">
{{chembox
| Name=[[Chloral hydrate]]
|Section5={{Chembox Pharmacology
| Legal_status =
| Legal_US = Schedule IV
| Legal_UK = 2
| Legal_AU =3
| Legal_CA = Non Controlled in CANADA
| PregCat = pc free text
| PregCat_AU = b
| PregCat_UK = pcuk
| PregCat_CA = pcca
| PregCat_US = C
| Licence_EU = ABC
| Licence_US = XYZ
  }}
}}</div>
<!-- ----- ----- ----- ----- ----- ----- ----- ----- ----- -----
--><div style="float:left;">
{{chembox/peskovnik
| Name=[[Chloral hydrate]]
|Section5={{Chembox Pharmacology/peskovnik
| Legal_status =
| Legal_US = Schedule IV
| Legal_UK = 2
| Legal_AU =3
| Legal_CA = Non Controlled in CANADA
| PregCat = pc free text
| PregCat_AU = b
| PregCat_UK = pcuk
| PregCat_CA = pcca
| PregCat_US = C
| Licence_EU = ABC
| Licence_US = XYZ
  }}
}}</div>{{clear}}

== REL ==
{{purge}} [[Wikipedia_talk:Chemical_infobox#Would_look_like]]
<div style="float=right;">
{{chembox<!-- OLD VERSION to compare -->
| Name=OLD (current) Chembox version
|Section1={{Chembox Hazards
| PEL={{abbr|TWA|Time-weighted average}} 400 ppm (1400 mg/m<sup>3</sup>)
| REL=PEL, and [[short-term exposure limit|ST]] 15 ppm (37 mg/m<sup>3</sup>)
| IDLH=2000 ppm
| NIOSH_id=0260
| NIOSH_ref=
  }}
}}</div>
<!-- ----- ----- ----- ----- ----- ----- ----- ----- ----- -----
 SANDBOX versions:
--><div style="float:left;">
{{chembox/peskovnik
|Section1={{Chembox Hazards/peskovnik
| PEL={{abbr|TWA|Time-weighted average}} 400 ppm (1400 mg/m<sup>3</sup>)
| REL=PEL, and [[short-term exposure limit|ST]] 15 ppm (37 mg/m<sup>3</sup>)
| IDLH=2000 ppm
| NIOSH_id=0260
| NIOSH_ref=<ref>{{navedi splet|url=https://www.cdc.gov/niosh/npg/default.html|title=Pocket Guide in general}}</ref>
  }}
}}</div>{{clear}}

<div style="float:left;">
{{chembox/peskovnik
| Name = v3
|Section1={{Chembox Hazards/peskovnik
| Name = demo PEL only
| REL=
| IDLH=
| NIOSH_id=0260
| NIOSH_ref=
  }}
}}</div>{{clear}}

<div style="float:left;">
{{chembox/peskovnik
| Name = demo REL only
|Section1={{Chembox Hazards/peskovnik
| PEL=
| REL=rel
| IDLH=
| NIOSH_id=0260
| NIOSH_ref=
  }}
}}</div>{{clear}}

<div style="float:left;">
{{chembox/peskovnik
| Name = demo IDLH only
|Section1={{Chembox Hazards/peskovnik
| PEL=
| REL=
| IDLH=IDLH
| NIOSH_id=
| NIOSH_ref=<ref>helloworld</ref>
  }}
}}</div>{{clear}}

====Blank REL test chemobox====
<div style="float:left;">
{{chembox/peskovnik
| Name=Blank test version (to edit)
|Section1={{Chembox Hazards/peskovnik
| Name = Ethyl formate
| REL= TWA 100 ppm (300 mg/m<sup>3</sup>) 
| IDLH= 1500 ppm
| NIOSH_id= 0278
| NIOSH_ref= <ref>{{PGCH|0278}}</ref>
  }}
}}</div>{{clear}}

==Teixobactin==
* [[Teixobactin]]
===drugbox===

{{Infobox drug
| drug_name         = Teixobactin
| IUPAC_name        = 
| image             = Teixobactin.svg
| width             = 250
| alt               = Teixobactin skeleton
| caption           = 

<!-- Clinical data -->
| tradename         = 
| Drugs.com         = 
| MedlinePlus       = 
| Pregnancy_AU      = <!-- A / B1 / B2 / B3 / C / D / X -->
| Pregnancy_US      = <!-- A / B            / C / D / X -->
| Pregnancy_category= 
| Legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| Legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| Legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| Legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| Legal_status      = Unscheduled
| routes_of_administration = 

<!-- Pharmacokinetic data -->
| bioavailability   = Unknown
| protein_bound     = Unknown
| metabolism        = Unknown
| onset             = Unknown
| elimination_half-life = Unknown
| excretion         = Unknown

<!-- Identifiers -->
| CAS_number        = 1613225-53-8
| ATCvet            = 
| ATC_prefix        = none
| ATC_suffix        = 
| PubChem           = 86341926
| DrugBank          = 
| ChemSpiderID      = 32786764

<!-- Chemical data -->
| chemical_formula  =  | C=58 | H=95 | N=15 | O=15|
| molecular_weight  = 1242.47&nbsp;[[gram|g]]/[[mole (unit)|mol]]
| smiles            = CC[C@H](C)[C@H]1C(=O)O[C@H]([C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)C[C@H]2CNC(=N)N2)C)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]([C@@H](C)CC)NC(=O)[C@@H](CCC(=O)N)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H](Cc3ccccc3)NC)C
| StdInChI          = 1/C58H95N15O15/c1-12-28(5)42(70-49(79)37(61-11)23-34-19-17-16-18-20-34)53(83)67-39(26-74)51(81)65-36(21-22-41(59)76)48(78)69-44(30(7)14-3)55(85)71-43(29(6)13-2)54(84)68-40(27-75)52(82)73-46-33(10)88-57(87)45(31(8)15-4)72-50(80)38(24-35-25-62-58(60)64-35)66-47(77)32(9)63-56(46)86/h16-20,28-33,35-40,42-46,61,74-75H,12-15,21-27H2,1-11H3,(H2,59,76)(H,63,86)(H,65,81)(H,66,77)(H,67,83)(H,68,84)(H,69,78)(H,70,79)(H,71,85)(H,72,80)(H,73,82)(H3,60,62,64)/t28-,29-,30-,31-,32-,33-,35-,36+,37+,38-,39-,40-,42-,43-,44+,45-,46+/m0/s1
}}
'''Teixobactin''' {{IPA-en|ˌteɪks.oʊ.ˈbæk.tɪn|}} 
{{clear}}

==(blank setup)==
<pre>
== (test) ==
{{purge}}
<div style="float=right;">
{{chembox
| Name = live

}}</div>
<!-- -->
<div style="float:left;">
{{chembox/peskovnik
| Name = sandboxes

}}</div>{{clear}}<!--
 ----- ----- ----- ----- ----- ----- ----- ----- ----- ----- -->
</pre>
==E number==
{{purge}}
<pre>
<div style="float=right;">
{{chembox
| Name = live
|E_number = 999
</pre>

{{purge}}
<div style="float=right;">
{{chembox
| Name = live
|E_number = 999

}}</div>
<!-- -->
<div style="float:left;">
{{chembox/peskovnik
| Name = sandboxes
|E_number = 999
}}</div>{{clear}}<!--

 ----- ----- ----- ----- ----- ----- ----- ----- ----- ----- -->

==refs==